C9H12N2O5S2 — CID 43214885
5-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 43214885) has the molecular formula C9H12N2O5S2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 43214885 |
| Molecular Formula | C9H12N2O5S2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 5-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | CN(C)C(=O)CNS(=O)(=O)c1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C9H12N2O5S2/c1-11(2)7(12)4-10-18(15,16)8-3-6(5-17-8)9(13)14/h3,5,10H,4H2,1-2H3,(H,13,14) |
| InChIKey | XUPRPJKRSGZZID-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |