C7H10N2O4S2 — CID 61402682
5-(2-aminoethylsulfamoyl)thiophene-3-carboxylic acid (PubChem CID 61402682) has the molecular formula C7H10N2O4S2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 5-(2-aminoethylsulfamoyl)thiophene-3-carboxylic acid.
| Compound Name | 5-(2-aminoethylsulfamoyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 61402682 |
| Molecular Formula | C7H10N2O4S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 5-(2-aminoethylsulfamoyl)thiophene-3-carboxylic acid |
| SMILES | NCCNS(=O)(=O)c1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C7H10N2O4S2/c8-1-2-9-15(12,13)6-3-5(4-14-6)7(10)11/h3-4,9H,1-2,8H2,(H,10,11) |
| InChIKey | UXOBLQUXMDTYNQ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |