C7H8N2O6S2 — CID 112672367
5-[(2-amino-2-oxoethoxy)sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 112672367) has the molecular formula C7H8N2O6S2 and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-[(2-amino-2-oxoethoxy)sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[(2-amino-2-oxoethoxy)sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 112672367 |
| Molecular Formula | C7H8N2O6S2 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 5-[(2-amino-2-oxoethoxy)sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | NC(=O)CONS(=O)(=O)c1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C7H8N2O6S2/c8-5(10)2-15-9-17(13,14)6-1-4(3-16-6)7(11)12/h1,3,9H,2H2,(H2,8,10)(H,11,12) |
| InChIKey | ZVFJFGBOVGZUIW-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|