C10H10N4O5S2 — CID 43612176
5-[[1-(2-amino-2-oxoethyl)pyrazol-4-yl]sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 43612176) has the molecular formula C10H10N4O5S2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 5-[[1-(2-amino-2-oxoethyl)pyrazol-4-yl]sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[[1-(2-amino-2-oxoethyl)pyrazol-4-yl]sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 43612176 |
| Molecular Formula | C10H10N4O5S2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 5-[[1-(2-amino-2-oxoethyl)pyrazol-4-yl]sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | NC(=O)Cn1cc(NS(=O)(=O)c2cc(C(=O)O)cs2)cn1 |
| InChI | InChI=1S/C10H10N4O5S2/c11-8(15)4-14-3-7(2-12-14)13-21(18,19)9-1-6(5-20-9)10(16)17/h1-3,5,13H,4H2,(H2,11,15)(H,16,17) |
| InChIKey | BSRHMTXFLQSZPO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |