C14H17N3O4S — CID 56813250
4-ethyl-3-[(1-ethylpyrazol-4-yl)sulfamoyl]benzoic acid (PubChem CID 56813250) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-ethyl-3-[(1-ethylpyrazol-4-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-ethyl-3-[(1-ethylpyrazol-4-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 56813250 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-ethyl-3-[(1-ethylpyrazol-4-yl)sulfamoyl]benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cnn(CC)c1 |
| InChI | InChI=1S/C14H17N3O4S/c1-3-10-5-6-11(14(18)19)7-13(10)22(20,21)16-12-8-15-17(4-2)9-12/h5-9,16H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | RITYOVRTCKDQBO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |