C12H12N4O4S — CID 114387125
4-ethyl-3-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid (PubChem CID 114387125) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is 4-ethyl-3-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid.
| Compound Name | 4-ethyl-3-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 114387125 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 4-ethyl-3-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Nc1nccnn1 |
| InChI | InChI=1S/C12H12N4O4S/c1-2-8-3-4-9(11(17)18)7-10(8)21(19,20)16-12-13-5-6-14-15-12/h3-7H,2H2,1H3,(H,17,18)(H,13,15,16) |
| InChIKey | RGDOASCTOQDFKU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |