C10H8N4O4S — CID 114387082
4-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid (PubChem CID 114387082) has the molecular formula C10H8N4O4S and a molecular weight of 280.26 g/mol. Its IUPAC name is 4-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid.
| Compound Name | 4-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 114387082 |
| Molecular Formula | C10H8N4O4S |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 4-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2nccnn2)cc1 |
| InChI | InChI=1S/C10H8N4O4S/c15-9(16)7-1-3-8(4-2-7)19(17,18)14-10-11-5-6-12-13-10/h1-6H,(H,15,16)(H,11,13,14) |
| InChIKey | GOSQYURLAAMLKQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |