C11H10N4O5S — CID 114387105
2-methoxy-5-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid (PubChem CID 114387105) has the molecular formula C11H10N4O5S and a molecular weight of 310.29 g/mol. Its IUPAC name is 2-methoxy-5-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid.
| Compound Name | 2-methoxy-5-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 114387105 |
| Molecular Formula | C11H10N4O5S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-methoxy-5-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2nccnn2)cc1C(=O)O |
| InChI | InChI=1S/C11H10N4O5S/c1-20-9-3-2-7(6-8(9)10(16)17)21(18,19)15-11-12-4-5-13-14-11/h2-6H,1H3,(H,16,17)(H,12,14,15) |
| InChIKey | ZHXKDGKDVQHYLY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |