C13H18N2O5S — CID 83005779
2-methoxy-5-(piperidin-1-ylsulfamoyl)benzoic acid (PubChem CID 83005779) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-methoxy-5-(piperidin-1-ylsulfamoyl)benzoic acid.
| Compound Name | 2-methoxy-5-(piperidin-1-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 83005779 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-methoxy-5-(piperidin-1-ylsulfamoyl)benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)NN2CCCCC2)cc1C(=O)O |
| InChI | InChI=1S/C13H18N2O5S/c1-20-12-6-5-10(9-11(12)13(16)17)21(18,19)14-15-7-3-2-4-8-15/h5-6,9,14H,2-4,7-8H2,1H3,(H,16,17) |
| InChIKey | HZJDWQMMKNFWLK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |