C14H11F2NO5S — CID 56812265
5-[(2,5-difluorophenyl)sulfamoyl]-2-methoxybenzoic acid (PubChem CID 56812265) has the molecular formula C14H11F2NO5S and a molecular weight of 343.31 g/mol. Its IUPAC name is 5-[(2,5-difluorophenyl)sulfamoyl]-2-methoxybenzoic acid.
| Compound Name | 5-[(2,5-difluorophenyl)sulfamoyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 56812265 |
| Molecular Formula | C14H11F2NO5S |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 5-[(2,5-difluorophenyl)sulfamoyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(F)ccc2F)cc1C(=O)O |
| InChI | InChI=1S/C14H11F2NO5S/c1-22-13-5-3-9(7-10(13)14(18)19)23(20,21)17-12-6-8(15)2-4-11(12)16/h2-7,17H,1H3,(H,18,19) |
| InChIKey | RTJXMIFSCRXCLI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |