C15H13F2NO5S — CID 47060124
2-[3-[(2,5-difluorophenyl)sulfamoyl]-4-methoxyphenyl]acetic acid (PubChem CID 47060124) has the molecular formula C15H13F2NO5S and a molecular weight of 357.33 g/mol. Its IUPAC name is 2-[3-[(2,5-difluorophenyl)sulfamoyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[(2,5-difluorophenyl)sulfamoyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 47060124 |
| Molecular Formula | C15H13F2NO5S |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 2-[3-[(2,5-difluorophenyl)sulfamoyl]-4-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1S(=O)(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C15H13F2NO5S/c1-23-13-5-2-9(7-15(19)20)6-14(13)24(21,22)18-12-8-10(16)3-4-11(12)17/h2-6,8,18H,7H2,1H3,(H,19,20) |
| InChIKey | DMNIHLJYMVQTMZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |