C16H16F2N2O4S — CID 28558028
N-[5-[(2,5-difluorophenyl)sulfamoyl]-2-methoxyphenyl]propanamide (PubChem CID 28558028) has the molecular formula C16H16F2N2O4S and a molecular weight of 370.38 g/mol. Its IUPAC name is N-[5-[(2,5-difluorophenyl)sulfamoyl]-2-methoxyphenyl]propanamide.
| Compound Name | N-[5-[(2,5-difluorophenyl)sulfamoyl]-2-methoxyphenyl]propanamide |
|---|---|
| PubChem CID | 28558028 |
| Molecular Formula | C16H16F2N2O4S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[5-[(2,5-difluorophenyl)sulfamoyl]-2-methoxyphenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(S(=O)(=O)Nc2cc(F)ccc2F)ccc1OC |
| InChI | InChI=1S/C16H16F2N2O4S/c1-3-16(21)19-14-9-11(5-7-15(14)24-2)25(22,23)20-13-8-10(17)4-6-12(13)18/h4-9,20H,3H2,1-2H3,(H,19,21) |
| InChIKey | PKWNMNRKDFVSEV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |