C19H16F2N2O6S2 — CID 29099021
2,5-difluoro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzenesulfonamide (PubChem CID 29099021) has the molecular formula C19H16F2N2O6S2 and a molecular weight of 470.48 g/mol. Its IUPAC name is 2,5-difluoro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 29099021 |
| Molecular Formula | C19H16F2N2O6S2 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 2,5-difluoro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(O)c(NS(=O)(=O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C19H16F2N2O6S2/c1-29-18-5-3-2-4-15(18)22-30(25,26)13-7-9-17(24)16(11-13)23-31(27,28)19-10-12(20)6-8-14(19)21/h2-11,22-24H,1H3 |
| InChIKey | WCVHDVMRVJAIMI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|