C19H24N2O4S2 — CID 28558016
N-[2-methoxy-5-[[(1S)-1-(4-methylsulfanylphenyl)ethyl]sulfamoyl]phenyl]propanamide (PubChem CID 28558016) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-[2-methoxy-5-[[(1S)-1-(4-methylsulfanylphenyl)ethyl]sulfamoyl]phenyl]propanamide.
| Compound Name | N-[2-methoxy-5-[[(1S)-1-(4-methylsulfanylphenyl)ethyl]sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 28558016 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-[2-methoxy-5-[[(1S)-1-(4-methylsulfanylphenyl)ethyl]sulfamoyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(S(=O)(=O)N[C@@H](C)c2ccc(SC)cc2)ccc1OC |
| InChI | InChI=1S/C19H24N2O4S2/c1-5-19(22)20-17-12-16(10-11-18(17)25-3)27(23,24)21-13(2)14-6-8-15(26-4)9-7-14/h6-13,21H,5H2,1-4H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | KIFCEEJRDSQDCT-ZDUSSCGKSA-N |
| XLogP | 3.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |