C17H22N2O5S3 — CID 92678167
4-methoxy-3-[(4-methylsulfanylphenyl)sulfonylamino]-N-propan-2-ylbenzenesulfonamide (PubChem CID 92678167) has the molecular formula C17H22N2O5S3 and a molecular weight of 430.57 g/mol. Its IUPAC name is 4-methoxy-3-[(4-methylsulfanylphenyl)sulfonylamino]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-methoxy-3-[(4-methylsulfanylphenyl)sulfonylamino]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 92678167 |
| Molecular Formula | C17H22N2O5S3 |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 4-methoxy-3-[(4-methylsulfanylphenyl)sulfonylamino]-N-propan-2-ylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C)cc1NS(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C17H22N2O5S3/c1-12(2)18-27(22,23)15-9-10-17(24-3)16(11-15)19-26(20,21)14-7-5-13(25-4)6-8-14/h5-12,18-19H,1-4H3 |
| InChIKey | RYJNEOUYMVNUDE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |