C14H19N5O6S3 — CID 100643873
N-[5-[[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 100643873) has the molecular formula C14H19N5O6S3 and a molecular weight of 449.54 g/mol. Its IUPAC name is N-[5-[[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 100643873 |
| Molecular Formula | C14H19N5O6S3 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | N-[5-[[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C)cc1NS(=O)(=O)c1nnc(NC(C)=O)s1 |
| InChI | InChI=1S/C14H19N5O6S3/c1-8(2)18-27(21,22)10-5-6-12(25-4)11(7-10)19-28(23,24)14-17-16-13(26-14)15-9(3)20/h5-8,18-19H,1-4H3,(H,15,16,20) |
| InChIKey | JCEJJSDIURPHQH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 156.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|