C15H19N5O6S3 — CID 100656363
N-[5-[(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 100656363) has the molecular formula C15H19N5O6S3 and a molecular weight of 461.55 g/mol. Its IUPAC name is N-[5-[(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 100656363 |
| Molecular Formula | C15H19N5O6S3 |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-[5-[(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1NS(=O)(=O)c1nnc(NC(C)=O)s1 |
| InChI | InChI=1S/C15H19N5O6S3/c1-10(21)16-14-17-18-15(27-14)28(22,23)19-12-9-11(5-6-13(12)26-2)29(24,25)20-7-3-4-8-20/h5-6,9,19H,3-4,7-8H2,1-2H3,(H,16,17,21) |
| InChIKey | PBYRUMFYOCQUPJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|