C21H28N2O5S2 — CID 29099743
N-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-4-ethylbenzenesulfonamide (PubChem CID 29099743) has the molecular formula C21H28N2O5S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-4-ethylbenzenesulfonamide.
| Compound Name | N-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 29099743 |
| Molecular Formula | C21H28N2O5S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cc(S(=O)(=O)N3CCCCCC3)ccc2OC)cc1 |
| InChI | InChI=1S/C21H28N2O5S2/c1-3-17-8-10-18(11-9-17)29(24,25)22-20-16-19(12-13-21(20)28-2)30(26,27)23-14-6-4-5-7-15-23/h8-13,16,22H,3-7,14-15H2,1-2H3 |
| InChIKey | WNUTUDVWDGHFJF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |