C18H21FN2O5S2 — CID 100691399
4-fluoro-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-methylbenzenesulfonamide (PubChem CID 100691399) has the molecular formula C18H21FN2O5S2 and a molecular weight of 428.51 g/mol. Its IUPAC name is 4-fluoro-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-methylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 100691399 |
| Molecular Formula | C18H21FN2O5S2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 4-fluoro-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1NS(=O)(=O)c1ccc(F)cc1C |
| InChI | InChI=1S/C18H21FN2O5S2/c1-13-11-14(19)5-8-18(13)27(22,23)20-16-12-15(6-7-17(16)26-2)28(24,25)21-9-3-4-10-21/h5-8,11-12,20H,3-4,9-10H2,1-2H3 |
| InChIKey | UVBPOVGYKPRGHI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |