C18H23N3O5S2 — CID 166184500
N-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]pyridine-3-sulfonamide (PubChem CID 166184500) has the molecular formula C18H23N3O5S2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]pyridine-3-sulfonamide.
| Compound Name | N-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 166184500 |
| Molecular Formula | C18H23N3O5S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]pyridine-3-sulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCCC2)cc1NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C18H23N3O5S2/c1-26-18-9-8-15(28(24,25)21-11-4-2-3-5-12-21)13-17(18)20-27(22,23)16-7-6-10-19-14-16/h6-10,13-14,20H,2-5,11-12H2,1H3 |
| InChIKey | DLPAGYYPIXQPCW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |