C18H21ClN2O5S2 — CID 99949913
1-(4-chlorophenyl)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)methanesulfonamide (PubChem CID 99949913) has the molecular formula C18H21ClN2O5S2 and a molecular weight of 444.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 99949913 |
| Molecular Formula | C18H21ClN2O5S2 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)methanesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1NS(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClN2O5S2/c1-26-18-9-8-16(28(24,25)21-10-2-3-11-21)12-17(18)20-27(22,23)13-14-4-6-15(19)7-5-14/h4-9,12,20H,2-3,10-11,13H2,1H3 |
| InChIKey | ALOBAYIYGZMJPM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |