C19H21N5O6S3 — CID 100625843
N-[5-[[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100625843) has the molecular formula C19H21N5O6S3 and a molecular weight of 511.61 g/mol. Its IUPAC name is N-[5-[[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-[[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100625843 |
| Molecular Formula | C19H21N5O6S3 |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | N-[5-[[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C)cc1NS(=O)(=O)c1nnc(NC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C19H21N5O6S3/c1-12(2)23-32(26,27)14-9-10-16(30-3)15(11-14)24-33(28,29)19-22-21-18(31-19)20-17(25)13-7-5-4-6-8-13/h4-12,23-24H,1-3H3,(H,20,21,25) |
| InChIKey | FBUUQHWIBSRIDH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 156.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|