C17H15N5O6S2 — CID 100678105
N-[5-[(2-methoxy-5-nitrophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide (PubChem CID 100678105) has the molecular formula C17H15N5O6S2 and a molecular weight of 449.47 g/mol. Its IUPAC name is N-[5-[(2-methoxy-5-nitrophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide.
| Compound Name | N-[5-[(2-methoxy-5-nitrophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 100678105 |
| Molecular Formula | C17H15N5O6S2 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | N-[5-[(2-methoxy-5-nitrophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1nnc(NC(=O)c2cccc(C)c2)s1 |
| InChI | InChI=1S/C17H15N5O6S2/c1-10-4-3-5-11(8-10)15(23)18-16-19-20-17(29-16)30(26,27)21-13-9-12(22(24)25)6-7-14(13)28-2/h3-9,21H,1-2H3,(H,18,19,23) |
| InChIKey | FTYOBOOGAKSYDS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 153.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|