C21H23N5O4S2 — CID 133262073
N-butan-2-yl-2-[[5-[(3-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]benzamide (PubChem CID 133262073) has the molecular formula C21H23N5O4S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-butan-2-yl-2-[[5-[(3-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]benzamide.
| Compound Name | N-butan-2-yl-2-[[5-[(3-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 133262073 |
| Molecular Formula | C21H23N5O4S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-butan-2-yl-2-[[5-[(3-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NS(=O)(=O)c1nnc(NC(=O)c2cccc(C)c2)s1 |
| InChI | InChI=1S/C21H23N5O4S2/c1-4-14(3)22-19(28)16-10-5-6-11-17(16)26-32(29,30)21-25-24-20(31-21)23-18(27)15-9-7-8-13(2)12-15/h5-12,14,26H,4H2,1-3H3,(H,22,28)(H,23,24,27) |
| InChIKey | BKZQUOGJTLTCJI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|