C24H19Cl2N5O4S2 — CID 133184982
2,4-dichloro-N-[5-[[2-(1-phenylethylcarbamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 133184982) has the molecular formula C24H19Cl2N5O4S2 and a molecular weight of 576.49 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[[2-(1-phenylethylcarbamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[[2-(1-phenylethylcarbamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 133184982 |
| Molecular Formula | C24H19Cl2N5O4S2 |
| Molecular Weight | 576.49 g/mol |
| Exact Mass | 575.03 |
| IUPAC Name | 2,4-dichloro-N-[5-[[2-(1-phenylethylcarbamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1NS(=O)(=O)c1nnc(NC(=O)c2ccc(Cl)cc2Cl)s1)c1ccccc1 |
| InChI | InChI=1S/C24H19Cl2N5O4S2/c1-14(15-7-3-2-4-8-15)27-22(33)18-9-5-6-10-20(18)31-37(34,35)24-30-29-23(36-24)28-21(32)17-12-11-16(25)13-19(17)26/h2-14,31H,1H3,(H,27,33)(H,28,29,32) |
| InChIKey | KYDCONRHIQVBOL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|