C19H15ClN4O7S2 — CID 100663798
dimethyl 2-[[5-[(2-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]benzene-1,4-dicarboxylate (PubChem CID 100663798) has the molecular formula C19H15ClN4O7S2 and a molecular weight of 510.94 g/mol. Its IUPAC name is dimethyl 2-[[5-[(2-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[5-[(2-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 100663798 |
| Molecular Formula | C19H15ClN4O7S2 |
| Molecular Weight | 510.94 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | dimethyl 2-[[5-[(2-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NS(=O)(=O)c2nnc(NC(=O)c3ccccc3Cl)s2)c1 |
| InChI | InChI=1S/C19H15ClN4O7S2/c1-30-16(26)10-7-8-12(17(27)31-2)14(9-10)24-33(28,29)19-23-22-18(32-19)21-15(25)11-5-3-4-6-13(11)20/h3-9,24H,1-2H3,(H,21,22,25) |
| InChIKey | HASHNJBYKHIHEU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.94 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|