C19H17ClN4O5S2 — CID 100761239
ethyl 3-[[5-[(4-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]-4-methylbenzoate (PubChem CID 100761239) has the molecular formula C19H17ClN4O5S2 and a molecular weight of 480.96 g/mol. Its IUPAC name is ethyl 3-[[5-[(4-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]-4-methylbenzoate.
| Compound Name | ethyl 3-[[5-[(4-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100761239 |
| Molecular Formula | C19H17ClN4O5S2 |
| Molecular Weight | 480.96 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | ethyl 3-[[5-[(4-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]-4-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C)c(NS(=O)(=O)c2nnc(NC(=O)c3ccc(Cl)cc3)s2)c1 |
| InChI | InChI=1S/C19H17ClN4O5S2/c1-3-29-17(26)13-5-4-11(2)15(10-13)24-31(27,28)19-23-22-18(30-19)21-16(25)12-6-8-14(20)9-7-12/h4-10,24H,3H2,1-2H3,(H,21,22,25) |
| InChIKey | CSRDWSAEVOKAMI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.96 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|