C18H17ClN4O3S2 — CID 100541989
N-[5-[2-(4-chlorophenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide (PubChem CID 100541989) has the molecular formula C18H17ClN4O3S2 and a molecular weight of 436.95 g/mol. Its IUPAC name is N-[5-[2-(4-chlorophenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide.
| Compound Name | N-[5-[2-(4-chlorophenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 100541989 |
| Molecular Formula | C18H17ClN4O3S2 |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | N-[5-[2-(4-chlorophenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nnc(S(=O)(=O)NCCc3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C18H17ClN4O3S2/c1-12-2-6-14(7-3-12)16(24)21-17-22-23-18(27-17)28(25,26)20-11-10-13-4-8-15(19)9-5-13/h2-9,20H,10-11H2,1H3,(H,21,22,24) |
| InChIKey | RKYCSESTKISDSX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|