C18H18N4O3S3 — CID 100725395
N-[5-[2-(4-methylphenyl)sulfanylethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100725395) has the molecular formula C18H18N4O3S3 and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[5-[2-(4-methylphenyl)sulfanylethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-[2-(4-methylphenyl)sulfanylethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100725395 |
| Molecular Formula | C18H18N4O3S3 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | N-[5-[2-(4-methylphenyl)sulfanylethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(SCCNS(=O)(=O)c2nnc(NC(=O)c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C18H18N4O3S3/c1-13-7-9-15(10-8-13)26-12-11-19-28(24,25)18-22-21-17(27-18)20-16(23)14-5-3-2-4-6-14/h2-10,19H,11-12H2,1H3,(H,20,21,23) |
| InChIKey | TWWTYFUHDXQNNJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|