C19H20N4O3S2 — CID 100563510
4-methyl-N-[5-(3-phenylpropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100563510) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 4-methyl-N-[5-(3-phenylpropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-methyl-N-[5-(3-phenylpropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100563510 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 4-methyl-N-[5-(3-phenylpropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2nnc(S(=O)(=O)NCCCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C19H20N4O3S2/c1-14-9-11-16(12-10-14)17(24)21-18-22-23-19(27-18)28(25,26)20-13-5-8-15-6-3-2-4-7-15/h2-4,6-7,9-12,20H,5,8,13H2,1H3,(H,21,22,24) |
| InChIKey | MSWSXSNZOYLZGV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|