C20H22N4O4S2 — CID 100558651
N-[5-[2-(2,4-dimethylphenoxy)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide (PubChem CID 100558651) has the molecular formula C20H22N4O4S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[5-[2-(2,4-dimethylphenoxy)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide.
| Compound Name | N-[5-[2-(2,4-dimethylphenoxy)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 100558651 |
| Molecular Formula | C20H22N4O4S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[5-[2-(2,4-dimethylphenoxy)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nnc(S(=O)(=O)NCCOc3ccc(C)cc3C)s2)cc1 |
| InChI | InChI=1S/C20H22N4O4S2/c1-13-4-7-16(8-5-13)18(25)22-19-23-24-20(29-19)30(26,27)21-10-11-28-17-9-6-14(2)12-15(17)3/h4-9,12,21H,10-11H2,1-3H3,(H,22,23,25) |
| InChIKey | NYLPUFKCAZYLMU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|