C22H26N4O3S2 — CID 100514267
2-methyl-N-[5-[3-(4-propan-2-ylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100514267) has the molecular formula C22H26N4O3S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-methyl-N-[5-[3-(4-propan-2-ylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-methyl-N-[5-[3-(4-propan-2-ylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100514267 |
| Molecular Formula | C22H26N4O3S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-methyl-N-[5-[3-(4-propan-2-ylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1nnc(S(=O)(=O)NCCCc2ccc(C(C)C)cc2)s1 |
| InChI | InChI=1S/C22H26N4O3S2/c1-15(2)18-12-10-17(11-13-18)8-6-14-23-31(28,29)22-26-25-21(30-22)24-20(27)19-9-5-4-7-16(19)3/h4-5,7,9-13,15,23H,6,8,14H2,1-3H3,(H,24,25,27) |
| InChIKey | HFXVFPONJJDSBU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|