C15H18N4O5S2 — CID 100663733
ethyl 3-methyl-4-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfonylamino]benzoate (PubChem CID 100663733) has the molecular formula C15H18N4O5S2 and a molecular weight of 398.47 g/mol. Its IUPAC name is ethyl 3-methyl-4-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfonylamino]benzoate.
| Compound Name | ethyl 3-methyl-4-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 100663733 |
| Molecular Formula | C15H18N4O5S2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | ethyl 3-methyl-4-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)c2nnc(NC(=O)CC)s2)c(C)c1 |
| InChI | InChI=1S/C15H18N4O5S2/c1-4-12(20)16-14-17-18-15(25-14)26(22,23)19-11-7-6-10(8-9(11)3)13(21)24-5-2/h6-8,19H,4-5H2,1-3H3,(H,16,17,20) |
| InChIKey | GOAAHVGYEUCAFM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|