C7H12N4O3S2 — CID 100748256
N-[5-(ethylsulfamoyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 100748256) has the molecular formula C7H12N4O3S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-[5-(ethylsulfamoyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-[5-(ethylsulfamoyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 100748256 |
| Molecular Formula | C7H12N4O3S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | N-[5-(ethylsulfamoyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCNS(=O)(=O)c1nnc(NC(=O)CC)s1 |
| InChI | InChI=1S/C7H12N4O3S2/c1-3-5(12)9-6-10-11-7(15-6)16(13,14)8-4-2/h8H,3-4H2,1-2H3,(H,9,10,12) |
| InChIKey | AHGKXKAWYCRZCJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|