C12H12Cl2N4O3S2 — CID 100568826
N-[5-[(2,4-dichlorophenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 100568826) has the molecular formula C12H12Cl2N4O3S2 and a molecular weight of 395.29 g/mol. Its IUPAC name is N-[5-[(2,4-dichlorophenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-[5-[(2,4-dichlorophenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 100568826 |
| Molecular Formula | C12H12Cl2N4O3S2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | N-[5-[(2,4-dichlorophenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)Nc1nnc(S(=O)(=O)NCc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C12H12Cl2N4O3S2/c1-2-10(19)16-11-17-18-12(22-11)23(20,21)15-6-7-3-4-8(13)5-9(7)14/h3-5,15H,2,6H2,1H3,(H,16,17,19) |
| InChIKey | RUUQECHEOMGPPQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|