C20H20Cl2N4O3S2 — CID 100612471
2,4-dichloro-N-[5-[(2,5-diethylphenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100612471) has the molecular formula C20H20Cl2N4O3S2 and a molecular weight of 499.45 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[(2,5-diethylphenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[(2,5-diethylphenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100612471 |
| Molecular Formula | C20H20Cl2N4O3S2 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 2,4-dichloro-N-[5-[(2,5-diethylphenyl)methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCc1ccc(CC)c(CNS(=O)(=O)c2nnc(NC(=O)c3ccc(Cl)cc3Cl)s2)c1 |
| InChI | InChI=1S/C20H20Cl2N4O3S2/c1-3-12-5-6-13(4-2)14(9-12)11-23-31(28,29)20-26-25-19(30-20)24-18(27)16-8-7-15(21)10-17(16)22/h5-10,23H,3-4,11H2,1-2H3,(H,24,25,27) |
| InChIKey | BMMPWPACUKLLTQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|