C14H14Cl2N4O4S2 — CID 100565713
2,4-dichloro-N-[5-[[(2R)-oxolan-2-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100565713) has the molecular formula C14H14Cl2N4O4S2 and a molecular weight of 437.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[[(2R)-oxolan-2-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[[(2R)-oxolan-2-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100565713 |
| Molecular Formula | C14H14Cl2N4O4S2 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 2,4-dichloro-N-[5-[[(2R)-oxolan-2-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)NC[C@H]2CCCO2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N4O4S2/c15-8-3-4-10(11(16)6-8)12(21)18-13-19-20-14(25-13)26(22,23)17-7-9-2-1-5-24-9/h3-4,6,9,17H,1-2,5,7H2,(H,18,19,21)/t9-/m1/s1 |
| InChIKey | VZAMKYBSZKUWDE-SECBINFHSA-N |
| XLogP | 2.55 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|