C16H20N4O5S2 — CID 51606970
2-(4-methylphenoxy)-N-[5-[[(2R)-oxolan-2-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 51606970) has the molecular formula C16H20N4O5S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-N-[5-[[(2R)-oxolan-2-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-methylphenoxy)-N-[5-[[(2R)-oxolan-2-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 51606970 |
| Molecular Formula | C16H20N4O5S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2-(4-methylphenoxy)-N-[5-[[(2R)-oxolan-2-yl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2nnc(S(=O)(=O)NC[C@H]3CCCO3)s2)cc1 |
| InChI | InChI=1S/C16H20N4O5S2/c1-11-4-6-12(7-5-11)25-10-14(21)18-15-19-20-16(26-15)27(22,23)17-9-13-3-2-8-24-13/h4-7,13,17H,2-3,8-10H2,1H3,(H,18,19,21)/t13-/m1/s1 |
| InChIKey | APUABARVFGTEIY-CYBMUJFWSA-N |
| XLogP | 1.32 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|