C16H19Cl2N5O3S2 — CID 100748234
2,4-dichloro-N-[5-(3-pyrrolidin-1-ylpropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100748234) has the molecular formula C16H19Cl2N5O3S2 and a molecular weight of 464.40 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-(3-pyrrolidin-1-ylpropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-(3-pyrrolidin-1-ylpropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100748234 |
| Molecular Formula | C16H19Cl2N5O3S2 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 2,4-dichloro-N-[5-(3-pyrrolidin-1-ylpropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)NCCCN2CCCC2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl2N5O3S2/c17-11-4-5-12(13(18)10-11)14(24)20-15-21-22-16(27-15)28(25,26)19-6-3-9-23-7-1-2-8-23/h4-5,10,19H,1-3,6-9H2,(H,20,21,24) |
| InChIKey | DPDUFFRFWSUNAQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|