C18H14Cl2N4O3S2 — CID 100734825
2,4-dichloro-N-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100734825) has the molecular formula C18H14Cl2N4O3S2 and a molecular weight of 469.38 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100734825 |
| Molecular Formula | C18H14Cl2N4O3S2 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | 2,4-dichloro-N-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)N2CCc3ccccc3C2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H14Cl2N4O3S2/c19-13-5-6-14(15(20)9-13)16(25)21-17-22-23-18(28-17)29(26,27)24-8-7-11-3-1-2-4-12(11)10-24/h1-6,9H,7-8,10H2,(H,21,22,25) |
| InChIKey | ATXCAGLNPNNGJL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|