C18H15ClN4O3S2 — CID 22517629
2-chloro-N-[5-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 22517629) has the molecular formula C18H15ClN4O3S2 and a molecular weight of 434.93 g/mol. Its IUPAC name is 2-chloro-N-[5-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 22517629 |
| Molecular Formula | C18H15ClN4O3S2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 2-chloro-N-[5-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CC1Cc2ccccc2N1S(=O)(=O)c1nnc(NC(=O)c2ccccc2Cl)s1 |
| InChI | InChI=1S/C18H15ClN4O3S2/c1-11-10-12-6-2-5-9-15(12)23(11)28(25,26)18-22-21-17(27-18)20-16(24)13-7-3-4-8-14(13)19/h2-9,11H,10H2,1H3,(H,20,21,24) |
| InChIKey | GPGHZRXLXFLYIS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|