C16H20N4O3S2 — CID 51427145
3-methyl-N-[5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 51427145) has the molecular formula C16H20N4O3S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is 3-methyl-N-[5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | 3-methyl-N-[5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 51427145 |
| Molecular Formula | C16H20N4O3S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 3-methyl-N-[5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CC(C)CC(=O)Nc1nnc(S(=O)(=O)N2c3ccccc3C[C@H]2C)s1 |
| InChI | InChI=1S/C16H20N4O3S2/c1-10(2)8-14(21)17-15-18-19-16(24-15)25(22,23)20-11(3)9-12-6-4-5-7-13(12)20/h4-7,10-11H,8-9H2,1-3H3,(H,17,18,21)/t11-/m1/s1 |
| InChIKey | PZZHBQZTUGTZRZ-LLVKDONJSA-N |
| XLogP | 2.66 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|