C18H15BrN4O3S2 — CID 51607003
3-bromo-N-[5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 51607003) has the molecular formula C18H15BrN4O3S2 and a molecular weight of 479.38 g/mol. Its IUPAC name is 3-bromo-N-[5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-bromo-N-[5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 51607003 |
| Molecular Formula | C18H15BrN4O3S2 |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 477.98 |
| IUPAC Name | 3-bromo-N-[5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | C[C@@H]1Cc2ccccc2N1S(=O)(=O)c1nnc(NC(=O)c2cccc(Br)c2)s1 |
| InChI | InChI=1S/C18H15BrN4O3S2/c1-11-9-12-5-2-3-8-15(12)23(11)28(25,26)18-22-21-17(27-18)20-16(24)13-6-4-7-14(19)10-13/h2-8,10-11H,9H2,1H3,(H,20,21,24)/t11-/m1/s1 |
| InChIKey | SSVXTVMDLACYSR-LLVKDONJSA-N |
| XLogP | 3.69 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|