C20H17ClN4O2S2 — CID 51687282
2-chloro-N-[5-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 51687282) has the molecular formula C20H17ClN4O2S2 and a molecular weight of 444.97 g/mol. Its IUPAC name is 2-chloro-N-[5-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 51687282 |
| Molecular Formula | C20H17ClN4O2S2 |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 2-chloro-N-[5-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | C[C@H]1Cc2ccccc2N1C(=O)CSc1nnc(NC(=O)c2ccccc2Cl)s1 |
| InChI | InChI=1S/C20H17ClN4O2S2/c1-12-10-13-6-2-5-9-16(13)25(12)17(26)11-28-20-24-23-19(29-20)22-18(27)14-7-3-4-8-15(14)21/h2-9,12H,10-11H2,1H3,(H,22,23,27)/t12-/m0/s1 |
| InChIKey | VPGDCPNNTXHVMJ-LBPRGKRZSA-N |
| XLogP | 4.51 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|