C15H13Cl2NO2S — CID 42994759
1-(2,6-dichlorophenyl)sulfonyl-2-methyl-2,3-dihydroindole (PubChem CID 42994759) has the molecular formula C15H13Cl2NO2S and a molecular weight of 342.25 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonyl-2-methyl-2,3-dihydroindole.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonyl-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 42994759 |
| Molecular Formula | C15H13Cl2NO2S |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonyl-2-methyl-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1S(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H13Cl2NO2S/c1-10-9-11-5-2-3-8-14(11)18(10)21(19,20)15-12(16)6-4-7-13(15)17/h2-8,10H,9H2,1H3 |
| InChIKey | KFAFSJJZKAWWCY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |