C14H12BrClN2O2S — CID 1034220
(2R)-1-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]-2-methyl-2,3-dihydroindole (PubChem CID 1034220) has the molecular formula C14H12BrClN2O2S and a molecular weight of 387.69 g/mol. Its IUPAC name is (2R)-1-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]-2-methyl-2,3-dihydroindole.
| Compound Name | (2R)-1-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 1034220 |
| Molecular Formula | C14H12BrClN2O2S |
| Molecular Weight | 387.69 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | (2R)-1-[(5-bromo-6-chloro-3-pyridinyl)sulfonyl]-2-methyl-2,3-dihydroindole |
| SMILES | C[C@@H]1Cc2ccccc2N1S(=O)(=O)c1cnc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H12BrClN2O2S/c1-9-6-10-4-2-3-5-13(10)18(9)21(19,20)11-7-12(15)14(16)17-8-11/h2-5,7-9H,6H2,1H3/t9-/m1/s1 |
| InChIKey | SFMMOEHTRIDDPD-SECBINFHSA-N |
| XLogP | 3.64 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|