C14H15Cl2N5O3S2 — CID 100761146
2,4-dichloro-N-[5-(4-methylpiperazin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100761146) has the molecular formula C14H15Cl2N5O3S2 and a molecular weight of 436.35 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-(4-methylpiperazin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-(4-methylpiperazin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100761146 |
| Molecular Formula | C14H15Cl2N5O3S2 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | 2,4-dichloro-N-[5-(4-methylpiperazin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CN1CCN(S(=O)(=O)c2nnc(NC(=O)c3ccc(Cl)cc3Cl)s2)CC1 |
| InChI | InChI=1S/C14H15Cl2N5O3S2/c1-20-4-6-21(7-5-20)26(23,24)14-19-18-13(25-14)17-12(22)10-3-2-9(15)8-11(10)16/h2-3,8H,4-7H2,1H3,(H,17,18,22) |
| InChIKey | GSVFUOHUOMKJHJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|