C14H14Cl2N4O3S2 — CID 100538861
2,4-dichloro-N-(5-piperidin-1-ylsulfonyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 100538861) has the molecular formula C14H14Cl2N4O3S2 and a molecular weight of 421.33 g/mol. Its IUPAC name is 2,4-dichloro-N-(5-piperidin-1-ylsulfonyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2,4-dichloro-N-(5-piperidin-1-ylsulfonyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 100538861 |
| Molecular Formula | C14H14Cl2N4O3S2 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 2,4-dichloro-N-(5-piperidin-1-ylsulfonyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)N2CCCCC2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N4O3S2/c15-9-4-5-10(11(16)8-9)12(21)17-13-18-19-14(24-13)25(22,23)20-6-2-1-3-7-20/h4-5,8H,1-3,6-7H2,(H,17,18,21) |
| InChIKey | GBGACXQBLDAHPI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|