C21H15Cl2N5O3S2 — CID 100559714
2,4-dichloro-N-[5-[[4-(pyridin-4-ylmethyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100559714) has the molecular formula C21H15Cl2N5O3S2 and a molecular weight of 520.42 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[[4-(pyridin-4-ylmethyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[[4-(pyridin-4-ylmethyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100559714 |
| Molecular Formula | C21H15Cl2N5O3S2 |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 519.00 |
| IUPAC Name | 2,4-dichloro-N-[5-[[4-(pyridin-4-ylmethyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)Nc2ccc(Cc3ccncc3)cc2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H15Cl2N5O3S2/c22-15-3-6-17(18(23)12-15)19(29)25-20-26-27-21(32-20)33(30,31)28-16-4-1-13(2-5-16)11-14-7-9-24-10-8-14/h1-10,12,28H,11H2,(H,25,26,29) |
| InChIKey | IUFKYJKPWFIPPC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|