C15H9BrCl2N4O3S2 — CID 100579791
N-[5-[(4-bromophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,4-dichlorobenzamide (PubChem CID 100579791) has the molecular formula C15H9BrCl2N4O3S2 and a molecular weight of 508.21 g/mol. Its IUPAC name is N-[5-[(4-bromophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[5-[(4-bromophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 100579791 |
| Molecular Formula | C15H9BrCl2N4O3S2 |
| Molecular Weight | 508.21 g/mol |
| Exact Mass | 505.87 |
| IUPAC Name | N-[5-[(4-bromophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)Nc2ccc(Br)cc2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H9BrCl2N4O3S2/c16-8-1-4-10(5-2-8)22-27(24,25)15-21-20-14(26-15)19-13(23)11-6-3-9(17)7-12(11)18/h1-7,22H,(H,19,20,23) |
| InChIKey | GUYHPKUEPKSZSO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.21 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|